C13H21N3O4S — CID 119110475
N-[2-(2,2-dimethylpropylamino)ethyl]-4-nitrobenzenesulfonamide (PubChem CID 119110475) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropylamino)ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2,2-dimethylpropylamino)ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119110475 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[2-(2,2-dimethylpropylamino)ethyl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)CNCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H21N3O4S/c1-13(2,3)10-14-8-9-15-21(19,20)12-6-4-11(5-7-12)16(17)18/h4-7,14-15H,8-10H2,1-3H3 |
| InChIKey | FJAGNJMJVUUVGU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|