C27H42N6O6 — CID 18954463
N,N'-bis(2,2-dimethylpropyl)propane-1,3-diamine;bis(4-nitrobenzamide) (PubChem CID 18954463) has the molecular formula C27H42N6O6 and a molecular weight of 546.67 g/mol. Its IUPAC name is N,N'-bis(2,2-dimethylpropyl)propane-1,3-diamine;bis(4-nitrobenzamide).
| Compound Name | N,N'-bis(2,2-dimethylpropyl)propane-1,3-diamine;bis(4-nitrobenzamide) |
|---|---|
| PubChem CID | 18954463 |
| Molecular Formula | C27H42N6O6 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N,N'-bis(2,2-dimethylpropyl)propane-1,3-diamine;bis(4-nitrobenzamide) |
| SMILES | CC(C)(C)CNCCCNCC(C)(C)C.NC(=O)c1ccc([N+](=O)[O-])cc1.NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H30N2.2C7H6N2O3/c1-12(2,3)10-14-8-7-9-15-11-13(4,5)6;2*8-7(10)5-1-3-6(4-2-5)9(11)12/h14-15H,7-11H2,1-6H3;2*1-4H,(H2,8,10) |
| InChIKey | BLSREKYRYMWHHE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|