C27H27N9O15S3 — CID 101227903
N-[2-[3,5-bis[2-[(4-nitrophenyl)sulfonylamino]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 101227903) has the molecular formula C27H27N9O15S3 and a molecular weight of 813.76 g/mol. Its IUPAC name is N-[2-[3,5-bis[2-[(4-nitrophenyl)sulfonylamino]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[3,5-bis[2-[(4-nitrophenyl)sulfonylamino]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101227903 |
| Molecular Formula | C27H27N9O15S3 |
| Molecular Weight | 813.76 g/mol |
| Exact Mass | 813.08 |
| IUPAC Name | N-[2-[3,5-bis[2-[(4-nitrophenyl)sulfonylamino]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | O=c1n(CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(=O)n(CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(=O)n1CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H27N9O15S3/c37-25-31(16-13-28-52(46,47)22-7-1-19(2-8-22)34(40)41)26(38)33(18-15-30-54(50,51)24-11-5-21(6-12-24)36(44)45)27(39)32(25)17-14-29-53(48,49)23-9-3-20(4-10-23)35(42)43/h1-12,28-30H,13-18H2 |
| InChIKey | BYHIFFCFKDFZEH-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 333.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.76 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|