C19H19N5O5S — CID 90542733
N-[2-(3-cyclopropyl-5-oxo-4-phenyl-1,2,4-triazol-1-yl)ethyl]-4-nitrobenzenesulfonamide (PubChem CID 90542733) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[2-(3-cyclopropyl-5-oxo-4-phenyl-1,2,4-triazol-1-yl)ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-(3-cyclopropyl-5-oxo-4-phenyl-1,2,4-triazol-1-yl)ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90542733 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[2-(3-cyclopropyl-5-oxo-4-phenyl-1,2,4-triazol-1-yl)ethyl]-4-nitrobenzenesulfonamide |
| SMILES | O=c1n(CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)nc(C2CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H19N5O5S/c25-19-22(21-18(14-6-7-14)23(19)15-4-2-1-3-5-15)13-12-20-30(28,29)17-10-8-16(9-11-17)24(26)27/h1-5,8-11,14,20H,6-7,12-13H2 |
| InChIKey | BLSKOSCWBZFHHT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|