C19H19N5O5S — CID 121077784
N-[2-(4-cyclopropyl-5-oxo-3-phenyl-1,2,4-triazol-1-yl)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 121077784) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-5-oxo-3-phenyl-1,2,4-triazol-1-yl)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(4-cyclopropyl-5-oxo-3-phenyl-1,2,4-triazol-1-yl)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121077784 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[2-(4-cyclopropyl-5-oxo-3-phenyl-1,2,4-triazol-1-yl)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | O=c1n(CCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)nc(-c2ccccc2)n1C1CC1 |
| InChI | InChI=1S/C19H19N5O5S/c25-19-22(21-18(23(19)15-9-10-15)14-5-2-1-3-6-14)12-11-20-30(28,29)17-8-4-7-16(13-17)24(26)27/h1-8,13,15,20H,9-12H2 |
| InChIKey | FPWWDOWUCNWVRJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|