C15H15F3N4O5S — CID 90615719
3-nitro-N-[2-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]ethyl]benzenesulfonamide (PubChem CID 90615719) has the molecular formula C15H15F3N4O5S and a molecular weight of 420.37 g/mol. Its IUPAC name is 3-nitro-N-[2-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[2-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90615719 |
| Molecular Formula | C15H15F3N4O5S |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 3-nitro-N-[2-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]ethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCCn2nc(C(F)(F)F)c3c2CCOC3)c1 |
| InChI | InChI=1S/C15H15F3N4O5S/c16-15(17,18)14-12-9-27-7-4-13(12)21(20-14)6-5-19-28(25,26)11-3-1-2-10(8-11)22(23)24/h1-3,8,19H,4-7,9H2 |
| InChIKey | GERNPYAKONHUKD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|