C21H27N4O5S+ — CID 91929622
[amino-[4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-3-oxopropyl]sulfamoyl]phenyl]methylidene]azanium (PubChem CID 91929622) has the molecular formula C21H27N4O5S+ and a molecular weight of 447.54 g/mol. Its IUPAC name is [amino-[4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-3-oxopropyl]sulfamoyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-3-oxopropyl]sulfamoyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 91929622 |
| Molecular Formula | C21H27N4O5S+ |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [amino-[4-[[3-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-3-oxopropyl]sulfamoyl]phenyl]methylidene]azanium |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(C(N)=[NH2+])cc2)cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-21(2,3)30-20(27)15-4-8-16(9-5-15)25-18(26)12-13-24-31(28,29)17-10-6-14(7-11-17)19(22)23/h4-11,24H,12-13H2,1-3H3,(H3,22,23)(H,25,26)/p+1 |
| InChIKey | UFIFBFHOQIHZMQ-UHFFFAOYSA-O |
| XLogP | 0.41 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|