C17H16N6O5S2 — CID 3588746
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N'-(4-nitrophenyl)sulfonylbenzohydrazide (PubChem CID 3588746) has the molecular formula C17H16N6O5S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N'-(4-nitrophenyl)sulfonylbenzohydrazide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N'-(4-nitrophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 3588746 |
| Molecular Formula | C17H16N6O5S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N'-(4-nitrophenyl)sulfonylbenzohydrazide |
| SMILES | Cn1cnnc1SCc1ccc(C(=O)NNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H16N6O5S2/c1-22-11-18-20-17(22)29-10-12-2-4-13(5-3-12)16(24)19-21-30(27,28)15-8-6-14(7-9-15)23(25)26/h2-9,11,21H,10H2,1H3,(H,19,24) |
| InChIKey | PEMPZKKLSDTIEE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|