C16H22N6OS3 — CID 8625599
1-(3-methylsulfanylpropyl)-3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]amino]thiourea (PubChem CID 8625599) has the molecular formula C16H22N6OS3 and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]amino]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 8625599 |
| Molecular Formula | C16H22N6OS3 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzoyl]amino]thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)c1ccc(CSc2nncn2C)cc1 |
| InChI | InChI=1S/C16H22N6OS3/c1-22-11-18-21-16(22)26-10-12-4-6-13(7-5-12)14(23)19-20-15(24)17-8-3-9-25-2/h4-7,11H,3,8-10H2,1-2H3,(H,19,23)(H2,17,20,24) |
| InChIKey | MSEVSMAUAHHISK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|