C15H13N5O4S2 — CID 25418619
N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-nitrobenzenesulfonamide (PubChem CID 25418619) has the molecular formula C15H13N5O4S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25418619 |
| Molecular Formula | C15H13N5O4S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-4-nitrobenzenesulfonamide |
| SMILES | Cn1cnnc1Sc1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H13N5O4S2/c1-19-10-16-17-15(19)25-13-6-2-11(3-7-13)18-26(23,24)14-8-4-12(5-9-14)20(21)22/h2-10,18H,1H3 |
| InChIKey | BRLDJBKBEYFBIA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|