C12H12ClN3O4S — CID 82813853
5-chloro-2-methyl-3-[(1-methylpyrazol-4-yl)sulfamoyl]benzoic acid (PubChem CID 82813853) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-[(1-methylpyrazol-4-yl)sulfamoyl]benzoic acid.
| Compound Name | 5-chloro-2-methyl-3-[(1-methylpyrazol-4-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 82813853 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 5-chloro-2-methyl-3-[(1-methylpyrazol-4-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C12H12ClN3O4S/c1-7-10(12(17)18)3-8(13)4-11(7)21(19,20)15-9-5-14-16(2)6-9/h3-6,15H,1-2H3,(H,17,18) |
| InChIKey | FTXPWDCYMUANBO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |