C17H20N2O4S3 — CID 2696922
N-(3-methylsulfanylphenyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 2696922) has the molecular formula C17H20N2O4S3 and a molecular weight of 412.56 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(3-methylsulfanylphenyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 2696922 |
| Molecular Formula | C17H20N2O4S3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CSc1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C17H20N2O4S3/c1-24-15-6-4-5-14(13-15)18-25(20,21)16-7-9-17(10-8-16)26(22,23)19-11-2-3-12-19/h4-10,13,18H,2-3,11-12H2,1H3 |
| InChIKey | CUJNDBXJZYQJES-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |