C17H24N4O2 — CID 138044191
1-(3-hydroxy-3-phenylbutyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea (PubChem CID 138044191) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(3-hydroxy-3-phenylbutyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea.
| Compound Name | 1-(3-hydroxy-3-phenylbutyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 138044191 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(3-hydroxy-3-phenylbutyl)-3-(1-pyrazol-1-ylpropan-2-yl)urea |
| SMILES | CC(Cn1cccn1)NC(=O)NCCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O2/c1-14(13-21-12-6-10-19-21)20-16(22)18-11-9-17(2,23)15-7-4-3-5-8-15/h3-8,10,12,14,23H,9,11,13H2,1-2H3,(H2,18,20,22) |
| InChIKey | BIHUZRMIRJOYKN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |