C13H17ClN4OS — CID 94101959
1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 94101959) has the molecular formula C13H17ClN4OS and a molecular weight of 312.83 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94101959 |
| Molecular Formula | C13H17ClN4OS |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(2S)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | C[C@@H](Cn1cccn1)NC(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H17ClN4OS/c1-10(9-18-8-2-6-16-18)17-13(19)15-7-5-11-3-4-12(14)20-11/h2-4,6,8,10H,5,7,9H2,1H3,(H2,15,17,19)/t10-/m0/s1 |
| InChIKey | LJWBZOUGWZAPHW-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |