C13H18N4OS — CID 94206368
1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 94206368) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94206368 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | Cc1ccsc1CNC(=O)N[C@H](C)Cn1cccn1 |
| InChI | InChI=1S/C13H18N4OS/c1-10-4-7-19-12(10)8-14-13(18)16-11(2)9-17-6-3-5-15-17/h3-7,11H,8-9H2,1-2H3,(H2,14,16,18)/t11-/m1/s1 |
| InChIKey | HQMBWPAZADKWOQ-LLVKDONJSA-N |
| XLogP | 2.14 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |