C14H24N2OS — CID 78880733
1-(5-methylhexan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]urea (PubChem CID 78880733) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 1-(5-methylhexan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1-(5-methylhexan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 78880733 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(5-methylhexan-2-yl)-3-[(3-methylthiophen-2-yl)methyl]urea |
| SMILES | Cc1ccsc1CNC(=O)NC(C)CCC(C)C |
| InChI | InChI=1S/C14H24N2OS/c1-10(2)5-6-12(4)16-14(17)15-9-13-11(3)7-8-18-13/h7-8,10,12H,5-6,9H2,1-4H3,(H2,15,16,17) |
| InChIKey | OJPCWUPTVUZMEV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |