C12H17N3O4S — CID 107831006
(2R)-5-amino-2-[(3-methylthiophen-2-yl)methylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 107831006) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2R)-5-amino-2-[(3-methylthiophen-2-yl)methylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(3-methylthiophen-2-yl)methylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107831006 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2R)-5-amino-2-[(3-methylthiophen-2-yl)methylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccsc1CNC(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H17N3O4S/c1-7-4-5-20-9(7)6-14-12(19)15-8(11(17)18)2-3-10(13)16/h4-5,8H,2-3,6H2,1H3,(H2,13,16)(H,17,18)(H2,14,15,19)/t8-/m1/s1 |
| InChIKey | WZYUCWIGCIQBKF-MRVPVSSYSA-N |
| XLogP | 0.57 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |