C13H18N4O4 — CID 63309082
(2S)-5-amino-2-[(3-methyl-2-pyridinyl)methylcarbamoylamino]-5-oxopentanoic acid (PubChem CID 63309082) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3-methyl-2-pyridinyl)methylcarbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3-methyl-2-pyridinyl)methylcarbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 63309082 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2S)-5-amino-2-[(3-methyl-2-pyridinyl)methylcarbamoylamino]-5-oxopentanoic acid |
| SMILES | Cc1cccnc1CNC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H18N4O4/c1-8-3-2-6-15-10(8)7-16-13(21)17-9(12(19)20)4-5-11(14)18/h2-3,6,9H,4-5,7H2,1H3,(H2,14,18)(H,19,20)(H2,16,17,21)/t9-/m0/s1 |
| InChIKey | MGOLATNEZADNMM-VIFPVBQESA-N |
| XLogP | -0.09 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |