C14H20N4OS — CID 94101998
1-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 94101998) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94101998 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | Cc1ccsc1CN(C)C(=O)N[C@H](C)Cn1cccn1 |
| InChI | InChI=1S/C14H20N4OS/c1-11-5-8-20-13(11)10-17(3)14(19)16-12(2)9-18-7-4-6-15-18/h4-8,12H,9-10H2,1-3H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | DHBODWJKEPROLR-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |