C17H22N6O — CID 126452559
1-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 126452559) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 126452559 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-methyl-1-[(1-methylbenzimidazol-2-yl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | C[C@H](Cn1cccn1)NC(=O)N(C)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C17H22N6O/c1-13(11-23-10-6-9-18-23)19-17(24)21(2)12-16-20-14-7-4-5-8-15(14)22(16)3/h4-10,13H,11-12H2,1-3H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | YMIFZKIDMSAWCI-CYBMUJFWSA-N |
| XLogP | 2.00 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |