C16H23N5O2 — CID 94206278
1-[(6-propan-2-yloxy-3-pyridinyl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 94206278) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(6-propan-2-yloxy-3-pyridinyl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-[(6-propan-2-yloxy-3-pyridinyl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 94206278 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(6-propan-2-yloxy-3-pyridinyl)methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | CC(C)Oc1ccc(CNC(=O)N[C@H](C)Cn2cccn2)cn1 |
| InChI | InChI=1S/C16H23N5O2/c1-12(2)23-15-6-5-14(9-17-15)10-18-16(22)20-13(3)11-21-8-4-7-19-21/h4-9,12-13H,10-11H2,1-3H3,(H2,18,20,22)/t13-/m1/s1 |
| InChIKey | QZLHXBSEGYGLDE-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |