C13H16N2O2S — CID 107706626
5-[1-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzene-1,3-diol (PubChem CID 107706626) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-[1-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706626 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-[1-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]benzene-1,3-diol |
| SMILES | CC(NC(C)c1nccs1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-8(10-5-11(16)7-12(17)6-10)15-9(2)13-14-3-4-18-13/h3-9,15-17H,1-2H3 |
| InChIKey | VSVJZUKNNRNNOW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |