C15H18N2O2 — CID 107706948
5-[1-[[(1S)-1-pyridin-4-ylethyl]amino]ethyl]benzene-1,3-diol (PubChem CID 107706948) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-[1-[[(1S)-1-pyridin-4-ylethyl]amino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[[(1S)-1-pyridin-4-ylethyl]amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706948 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-[1-[[(1S)-1-pyridin-4-ylethyl]amino]ethyl]benzene-1,3-diol |
| SMILES | CC(N[C@@H](C)c1ccncc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-10(12-3-5-16-6-4-12)17-11(2)13-7-14(18)9-15(19)8-13/h3-11,17-19H,1-2H3/t10-,11?/m0/s1 |
| InChIKey | PRVSBTBERIHSEX-VUWPPUDQSA-N |
| XLogP | 2.90 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |