C12H14N2OS — CID 112731172
N-[1-(3-methoxyphenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 112731172) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(3-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 112731172 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-[1-(3-methoxyphenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(C(C)Nc2nccs2)c1 |
| InChI | InChI=1S/C12H14N2OS/c1-9(14-12-13-6-7-16-12)10-4-3-5-11(8-10)15-2/h3-9H,1-2H3,(H,13,14) |
| InChIKey | QWLPZPVUBCYORU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |