2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid

C12H11N3O3S — CID 61188411

IUPAC2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NC(=O)Nc2nccs2)cc1
InChIInChI=1S/C12H11N3O3S/c16-10(17)7-8-1-3-9(4-2-8)14-11(18)15-12-13-5-6-19-12/h1-6H,7H2,(H,16,17)(H2,13,14,15,18)
InChIKeyYQHITQSRFZIFPE-UHFFFAOYSA-N
MW277.31 g/mol
LogP2.41
Rot. Bonds4

About 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid

2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid (PubChem CID 61188411) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid
PubChem CID61188411
Molecular FormulaC12H11N3O3S
Molecular Weight277.31 g/mol
Exact Mass277.05
IUPAC Name2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid
SMILESO=C(O)Cc1ccc(NC(=O)Nc2nccs2)cc1
InChIInChI=1S/C12H11N3O3S/c16-10(17)7-8-1-3-9(4-2-8)14-11(18)15-12-13-5-6-19-12/h1-6H,7H2,(H,16,17)(H2,13,14,15,18)
InChIKeyYQHITQSRFZIFPE-UHFFFAOYSA-N
XLogP2.41
TPSA91.32 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.31
LogP ≤ 52.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid?
The IUPAC name of 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid (CID 61188411) is 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid?
The canonical SMILES for 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid is O=C(O)Cc1ccc(NC(=O)Nc2nccs2)cc1.
What is the InChIKey of 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid?
The InChIKey is YQHITQSRFZIFPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3S/c16-10(17)7-8-1-3-9(4-2-8)14-11(18)15-12-13-5-6-19-12/h1-6H,7H2,(H,16,17)(H2,13,14,15,18).
What are the key properties of 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid?
2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid has a molecular weight of 277.31 g/mol, XLogP of 2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-thiazol-2-ylcarbamoylamino)phenyl]acetic acid is sourced from PubChem (CID 61188411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).