C19H24N4O6 — CID 8657966
[(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate (PubChem CID 8657966) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate.
| Compound Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 8657966 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(1R)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoate |
| SMILES | CCNC(=O)NC(=O)[C@H](OC(=O)CCN1C(=O)NC(C)(C)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H24N4O6/c1-4-20-17(27)21-15(25)14(12-8-6-5-7-9-12)29-13(24)10-11-23-16(26)19(2,3)22-18(23)28/h5-9,14H,4,10-11H2,1-3H3,(H,22,28)(H2,20,21,25,27)/t14-/m1/s1 |
| InChIKey | UPPOBOOIZGZUGW-CQSZACIVSA-N |
| XLogP | 0.84 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|