C16H16F3N3O6 — CID 7209845
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7209845) has the molecular formula C16H16F3N3O6 and a molecular weight of 403.31 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7209845 |
| Molecular Formula | C16H16F3N3O6 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C16H16F3N3O6/c1-15(2)13(25)22(14(26)21-15)7-12(24)27-8-11(23)20-9-3-5-10(6-4-9)28-16(17,18)19/h3-6H,7-8H2,1-2H3,(H,20,23)(H,21,26) |
| InChIKey | CLGPOTCGKUVPCY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|