C14H14Cl2N4O5 — CID 41047572
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 41047572) has the molecular formula C14H14Cl2N4O5 and a molecular weight of 389.20 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 41047572 |
| Molecular Formula | C14H14Cl2N4O5 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C14H14Cl2N4O5/c1-14(2)12(23)20(13(24)19-14)5-10(22)25-6-9(21)18-11-8(16)3-7(15)4-17-11/h3-4H,5-6H2,1-2H3,(H,19,24)(H,17,18,21) |
| InChIKey | QTVJFCDYESKHRE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|