C22H22N4O4 — CID 40856002
N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide (PubChem CID 40856002) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide.
| Compound Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40856002 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-(2-methyl-1,3-benzoxazol-5-yl)-2-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
| SMILES | Cc1nc2cc(NC(=O)CN3C(=O)N[C@@](C)(CCc4ccccc4)C3=O)ccc2o1 |
| InChI | InChI=1S/C22H22N4O4/c1-14-23-17-12-16(8-9-18(17)30-14)24-19(27)13-26-20(28)22(2,25-21(26)29)11-10-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,24,27)(H,25,29)/t22-/m0/s1 |
| InChIKey | VBWGYFOVFPOYPV-QFIPXVFZSA-N |
| XLogP | 3.02 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|