C20H25N5O3 — CID 134044696
N-(1-ethylbenzimidazol-2-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 134044696) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(1-ethylbenzimidazol-2-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(1-ethylbenzimidazol-2-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 134044696 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(1-ethylbenzimidazol-2-yl)-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCn1c(NC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)nc2ccccc21 |
| InChI | InChI=1S/C20H25N5O3/c1-3-24-15-7-5-4-6-14(15)21-18(24)22-16(26)12-25-17(27)20(23-19(25)28)10-8-13(2)9-11-20/h4-7,13H,3,8-12H2,1-2H3,(H,23,28)(H,21,22,26) |
| InChIKey | ZRITYPDPRQLXEG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|