C21H28N4O4 — CID 55612985
2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 55612985) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55612985 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccccc1C(=O)N(C)C)C2=O |
| InChI | InChI=1S/C21H28N4O4/c1-4-14-9-11-21(12-10-14)19(28)25(20(29)23-21)13-17(26)22-16-8-6-5-7-15(16)18(27)24(2)3/h5-8,14H,4,9-13H2,1-3H3,(H,22,26)(H,23,29) |
| InChIKey | ZMVZGSRPHYPPLN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|