C19H25ClN4O5 — CID 119618318
N-(6-amino-1,3-benzodioxol-5-yl)-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride (PubChem CID 119618318) has the molecular formula C19H25ClN4O5 and a molecular weight of 424.89 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119618318 |
| Molecular Formula | C19H25ClN4O5 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1cc3c(cc1N)OCO3)C2=O.Cl |
| InChI | InChI=1S/C19H24N4O5.ClH/c1-2-11-3-5-19(6-4-11)17(25)23(18(26)22-19)9-16(24)21-13-8-15-14(7-12(13)20)27-10-28-15;/h7-8,11H,2-6,9-10,20H2,1H3,(H,21,24)(H,22,26);1H |
| InChIKey | PXFPDLSNZZFEJV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|