C20H23N3O6 — CID 7240816
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide (PubChem CID 7240816) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
|---|---|
| PubChem CID | 7240816 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)CN1C(=O)NC3(CCCCCC3)C1=O)OCO2 |
| InChI | InChI=1S/C20H23N3O6/c1-12(24)13-8-15-16(29-11-28-15)9-14(13)21-17(25)10-23-18(26)20(22-19(23)27)6-4-2-3-5-7-20/h8-9H,2-7,10-11H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | BPINSCOGZKOAEM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|