C21H18FN3O6 — CID 46512802
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 46512802) has the molecular formula C21H18FN3O6 and a molecular weight of 427.39 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46512802 |
| Molecular Formula | C21H18FN3O6 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)CN1C(=O)NC(C)(c3ccc(F)cc3)C1=O)OCO2 |
| InChI | InChI=1S/C21H18FN3O6/c1-11(26)14-7-16-17(31-10-30-16)8-15(14)23-18(27)9-25-19(28)21(2,24-20(25)29)12-3-5-13(22)6-4-12/h3-8H,9-10H2,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | RWKGJRKNRWNARO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|