C27H32N4O3 — CID 55895207
N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55895207) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55895207 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1ccccc1CN1CCc3ccccc31)C2=O |
| InChI | InChI=1S/C27H32N4O3/c1-2-19-11-14-27(15-12-19)25(33)31(26(34)29-27)18-24(32)28-22-9-5-3-8-21(22)17-30-16-13-20-7-4-6-10-23(20)30/h3-10,19H,2,11-18H2,1H3,(H,28,32)(H,29,34) |
| InChIKey | XOBDRWSVSKUYNX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|