C22H19FN2O7S — CID 2620658
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2620658) has the molecular formula C22H19FN2O7S and a molecular weight of 474.47 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2620658 |
| Molecular Formula | C22H19FN2O7S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H19FN2O7S/c1-13-9-18(14(2)24(13)17-6-4-5-16(23)11-17)20(26)12-32-22(27)15-7-8-21(33(3,30)31)19(10-15)25(28)29/h4-11H,12H2,1-3H3 |
| InChIKey | COWFOABZEOJSLV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 125.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|