C25H25FN2O5 — CID 46609709
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-(furan-2-carbonyl)piperidine-4-carboxylate (PubChem CID 46609709) has the molecular formula C25H25FN2O5 and a molecular weight of 452.48 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-(furan-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-(furan-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46609709 |
| Molecular Formula | C25H25FN2O5 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-(furan-2-carbonyl)piperidine-4-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)C2CCN(C(=O)c3ccco3)CC2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C25H25FN2O5/c1-16-13-21(17(2)28(16)20-6-3-5-19(26)14-20)22(29)15-33-25(31)18-8-10-27(11-9-18)24(30)23-7-4-12-32-23/h3-7,12-14,18H,8-11,15H2,1-2H3 |
| InChIKey | QODQUNYHXGIHEO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|