C20H18BrN3O4 — CID 4277593
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(6-methyl-2-nitro-3-pyridinyl)oxy]ethanone (PubChem CID 4277593) has the molecular formula C20H18BrN3O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(6-methyl-2-nitro-3-pyridinyl)oxy]ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(6-methyl-2-nitro-3-pyridinyl)oxy]ethanone |
|---|---|
| PubChem CID | 4277593 |
| Molecular Formula | C20H18BrN3O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(6-methyl-2-nitro-3-pyridinyl)oxy]ethanone |
| SMILES | Cc1ccc(OCC(=O)c2cc(C)n(-c3ccc(Br)cc3)c2C)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H18BrN3O4/c1-12-4-9-19(20(22-12)24(26)27)28-11-18(25)17-10-13(2)23(14(17)3)16-7-5-15(21)6-8-16/h4-10H,11H2,1-3H3 |
| InChIKey | ALVCASVDLQKXJI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|