C12H16BF3O4 — CID 82789983
[4-[2-(4,4,4-trifluorobutoxy)ethoxy]phenyl]boronic acid (PubChem CID 82789983) has the molecular formula C12H16BF3O4 and a molecular weight of 292.06 g/mol. Its IUPAC name is [4-[2-(4,4,4-trifluorobutoxy)ethoxy]phenyl]boronic acid.
| Compound Name | [4-[2-(4,4,4-trifluorobutoxy)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 82789983 |
| Molecular Formula | C12H16BF3O4 |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [4-[2-(4,4,4-trifluorobutoxy)ethoxy]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCCOCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16BF3O4/c14-12(15,16)6-1-7-19-8-9-20-11-4-2-10(3-5-11)13(17)18/h2-5,17-18H,1,6-9H2 |
| InChIKey | GSNJHYDLUNYEOH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|