C18H27NO3 — CID 144995839
(3S)-9-methyl-3-(methylamino)-7-(3-phenylpropyl)-1,5-dioxonan-2-one (PubChem CID 144995839) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3S)-9-methyl-3-(methylamino)-7-(3-phenylpropyl)-1,5-dioxonan-2-one.
| Compound Name | (3S)-9-methyl-3-(methylamino)-7-(3-phenylpropyl)-1,5-dioxonan-2-one |
|---|---|
| PubChem CID | 144995839 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (3S)-9-methyl-3-(methylamino)-7-(3-phenylpropyl)-1,5-dioxonan-2-one |
| SMILES | CN[C@H]1COCC(CCCc2ccccc2)CC(C)OC1=O |
| InChI | InChI=1S/C18H27NO3/c1-14-11-16(10-6-9-15-7-4-3-5-8-15)12-21-13-17(19-2)18(20)22-14/h3-5,7-8,14,16-17,19H,6,9-13H2,1-2H3/t14?,16?,17-/m0/s1 |
| InChIKey | XIKSFRMVVVVTOL-PREGVCBESA-N |
| XLogP | 2.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |