C11H10BrFN2O2 — CID 172609781
3-(4-bromo-2-fluoroanilino)piperidine-2,6-dione (PubChem CID 172609781) has the molecular formula C11H10BrFN2O2 and a molecular weight of 301.12 g/mol. Its IUPAC name is 3-(4-bromo-2-fluoroanilino)piperidine-2,6-dione.
| Compound Name | 3-(4-bromo-2-fluoroanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 172609781 |
| Molecular Formula | C11H10BrFN2O2 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 3-(4-bromo-2-fluoroanilino)piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(Br)cc2F)C(=O)N1 |
| InChI | InChI=1S/C11H10BrFN2O2/c12-6-1-2-8(7(13)5-6)14-9-3-4-10(16)15-11(9)17/h1-2,5,9,14H,3-4H2,(H,15,16,17) |
| InChIKey | WIIPYXGYUPIOEE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|