C16H21ClFN3O2 — CID 170728957
(3S)-3-(3-fluoro-2-piperidin-4-ylanilino)piperidine-2,6-dione;hydrochloride (PubChem CID 170728957) has the molecular formula C16H21ClFN3O2 and a molecular weight of 341.81 g/mol. Its IUPAC name is (3S)-3-(3-fluoro-2-piperidin-4-ylanilino)piperidine-2,6-dione;hydrochloride.
| Compound Name | (3S)-3-(3-fluoro-2-piperidin-4-ylanilino)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170728957 |
| Molecular Formula | C16H21ClFN3O2 |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (3S)-3-(3-fluoro-2-piperidin-4-ylanilino)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CC[C@H](Nc2cccc(F)c2C2CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C16H20FN3O2.ClH/c17-11-2-1-3-12(15(11)10-6-8-18-9-7-10)19-13-4-5-14(21)20-16(13)22;/h1-3,10,13,18-19H,4-9H2,(H,20,21,22);1H/t13-;/m0./s1 |
| InChIKey | ZPAJFZBESKEQNM-ZOWNYOTGSA-N |
| XLogP | 1.93 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|