C14H19N5O2 — CID 166117145
3-[(2-piperidin-4-ylpyrimidin-5-yl)amino]piperidine-2,6-dione (PubChem CID 166117145) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-[(2-piperidin-4-ylpyrimidin-5-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(2-piperidin-4-ylpyrimidin-5-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166117145 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-[(2-piperidin-4-ylpyrimidin-5-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2cnc(C3CCNCC3)nc2)C(=O)N1 |
| InChI | InChI=1S/C14H19N5O2/c20-12-2-1-11(14(21)19-12)18-10-7-16-13(17-8-10)9-3-5-15-6-4-9/h7-9,11,15,18H,1-6H2,(H,19,20,21) |
| InChIKey | FLDWSRSHTGZNSS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|