C11H8BrF3N2O3 — CID 103193075
3-[4-bromo-2-(trifluoromethoxy)anilino]pyrrolidine-2,5-dione (PubChem CID 103193075) has the molecular formula C11H8BrF3N2O3 and a molecular weight of 353.09 g/mol. Its IUPAC name is 3-[4-bromo-2-(trifluoromethoxy)anilino]pyrrolidine-2,5-dione.
| Compound Name | 3-[4-bromo-2-(trifluoromethoxy)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 103193075 |
| Molecular Formula | C11H8BrF3N2O3 |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3-[4-bromo-2-(trifluoromethoxy)anilino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc(Br)cc2OC(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C11H8BrF3N2O3/c12-5-1-2-6(8(3-5)20-11(13,14)15)16-7-4-9(18)17-10(7)19/h1-3,7,16H,4H2,(H,17,18,19) |
| InChIKey | HPJSZEVNPXPXJM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|