C15H19BrF3NO — CID 103192978
4-bromo-N-(2,6-dimethylcyclohexyl)-2-(trifluoromethoxy)aniline (PubChem CID 103192978) has the molecular formula C15H19BrF3NO and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dimethylcyclohexyl)-2-(trifluoromethoxy)aniline.
| Compound Name | 4-bromo-N-(2,6-dimethylcyclohexyl)-2-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 103192978 |
| Molecular Formula | C15H19BrF3NO |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 4-bromo-N-(2,6-dimethylcyclohexyl)-2-(trifluoromethoxy)aniline |
| SMILES | CC1CCCC(C)C1Nc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H19BrF3NO/c1-9-4-3-5-10(2)14(9)20-12-7-6-11(16)8-13(12)21-15(17,18)19/h6-10,14,20H,3-5H2,1-2H3 |
| InChIKey | QRXYTYFUQBWADE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |