C22H22N4O6 — CID 118895757
N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-5,6-dihydroisoindol-5-yl]methyl]-6-ethoxypyridine-3-carboxamide (PubChem CID 118895757) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-5,6-dihydroisoindol-5-yl]methyl]-6-ethoxypyridine-3-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-5,6-dihydroisoindol-5-yl]methyl]-6-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 118895757 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-5,6-dihydroisoindol-5-yl]methyl]-6-ethoxypyridine-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCC2C=C3C(=O)N(C4CCC(=O)NC4=O)C(=O)C3=CC2)cn1 |
| InChI | InChI=1S/C22H22N4O6/c1-2-32-18-8-4-13(11-23-18)19(28)24-10-12-3-5-14-15(9-12)22(31)26(21(14)30)16-6-7-17(27)25-20(16)29/h4-5,8-9,11-12,16H,2-3,6-7,10H2,1H3,(H,24,28)(H,25,27,29) |
| InChIKey | JSWWUXXUMLTLRL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|