C21H22ClN3O2 — CID 151513636
3-[4-[[4-(chloromethyl)phenyl]methylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 151513636) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[4-[[4-(chloromethyl)phenyl]methylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(chloromethyl)phenyl]methylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 151513636 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[4-[[4-(chloromethyl)phenyl]methylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(NCc4ccc(CCl)cc4)c3C2)C(=O)N1 |
| InChI | InChI=1S/C21H22ClN3O2/c22-10-14-4-6-15(7-5-14)11-23-18-3-1-2-16-12-25(13-17(16)18)19-8-9-20(26)24-21(19)27/h1-7,19,23H,8-13H2,(H,24,26,27) |
| InChIKey | PSZPUYYDMXTJIV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|