C30H38N6O9 — CID 156528105
3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethylcarbamoylamino]-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]benzamide (PubChem CID 156528105) has the molecular formula C30H38N6O9 and a molecular weight of 626.67 g/mol. Its IUPAC name is 3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethylcarbamoylamino]-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethylcarbamoylamino]-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 156528105 |
| Molecular Formula | C30H38N6O9 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethylcarbamoylamino]-N-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C1CCC(N2Cc3cc(NCCNC(=O)Nc4cccc(C(=O)NCCOCCOCCOCO)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H38N6O9/c37-19-45-15-14-44-13-12-43-11-10-32-27(39)20-2-1-3-23(16-20)34-30(42)33-9-8-31-22-4-5-24-21(17-22)18-36(29(24)41)25-6-7-26(38)35-28(25)40/h1-5,16-17,25,31,37H,6-15,18-19H2,(H,32,39)(H2,33,34,42)(H,35,38,40) |
| InChIKey | CXMFQZCSGODVKF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|