C25H28N4O4 — CID 166426747
1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-methyl-2-(3-methylphenyl)propyl]urea (PubChem CID 166426747) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-methyl-2-(3-methylphenyl)propyl]urea.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-methyl-2-(3-methylphenyl)propyl]urea |
|---|---|
| PubChem CID | 166426747 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-[2-methyl-2-(3-methylphenyl)propyl]urea |
| SMILES | Cc1cccc(C(C)(C)CNC(=O)Nc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C25H28N4O4/c1-15-5-4-6-17(11-15)25(2,3)14-26-24(33)27-18-7-8-19-16(12-18)13-29(23(19)32)20-9-10-21(30)28-22(20)31/h4-8,11-12,20H,9-10,13-14H2,1-3H3,(H2,26,27,33)(H,28,30,31) |
| InChIKey | SLBSJLDOEHUTAD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|