C23H23ClN4O5 — CID 176565071
1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea (PubChem CID 176565071) has the molecular formula C23H23ClN4O5 and a molecular weight of 470.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
|---|---|
| PubChem CID | 176565071 |
| Molecular Formula | C23H23ClN4O5 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-1-hydroxypropan-2-yl]-3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]urea |
| SMILES | CC(CO)(NC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN4O5/c1-23(12-29,14-2-4-15(24)5-3-14)27-22(33)25-16-6-7-17-13(10-16)11-28(21(17)32)18-8-9-19(30)26-20(18)31/h2-7,10,18,29H,8-9,11-12H2,1H3,(H2,25,27,33)(H,26,30,31) |
| InChIKey | ZZFVERVEHNJBOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|